Products 1240528-32-8

CAS 1240528-32-8 appears in our catalog under these names: 4-(1H-1,3-Benzodiazol-1-yl)benzoic acid hydrochloride, 95%, 4-(1H-1,3-Benzodiazol-1-yl)benzoic acid hydrochloride, 4-(1H-1,3-benzodiazol-1-yl)benzoic acid hydrochloride, 95%, 95%, 4-(1H-Benzo[d]imidazol-1-yl)benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.

Structural formula: {0} (CAS {1})

4-(benzimidazol-1-yl)benzoic acid;hydrochloride (CAS 1240528-32-8) is a chemical compound with the molecular formula C14H11ClN2O2 and a molecular weight of 274.70 g/mol. IUPAC name: 4-(benzimidazol-1-yl)benzoic acid;hydrochloride. InChIKey: BGQKHOJPXHEWIO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClN2O2
Molecular weight274.70 g/mol
IUPAC name4-(benzimidazol-1-yl)benzoic acid;hydrochloride
InChIKeyBGQKHOJPXHEWIO-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)N=CN2C3=CC=C(C=C3)C(=O)O.Cl

Computed by PubChem (NCBI)