Products 923729-61-7
CAS 923729-61-7 is the registry number for 2-(Chloromethyl)-3-(furan-2-ylmethyl)-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(chloromethyl)-3-(furan-2-ylmethyl)quinazolin-4-one (CAS 923729-61-7) is a chemical compound with the molecular formula C14H11ClN2O2 and a molecular weight of 274.70 g/mol. IUPAC name: 2-(chloromethyl)-3-(furan-2-ylmethyl)quinazolin-4-one. InChIKey: IUOSKJVPOABQDY-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 2-(chloromethyl)-3-(furan-2-ylmethyl)quinazolin-4-one |
| InChIKey | IUOSKJVPOABQDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=N2)CCl)CC3=CC=CO3 |
Computed by PubChem (NCBI)