CAS 51145-18-7 appears in our catalog under these names: N-Nitroso Temazepam EP Impurity A, N-Nitroso Methyl Aniline Derivative, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
N-(2-benzoyl-4-chlorophenyl)-N-methylnitrous amide (CAS 51145-18-7) is a chemical compound with the molecular formula C14H11ClN2O2 and a molecular weight of 274.70 g/mol. IUPAC name: N-(2-benzoyl-4-chlorophenyl)-N-methylnitrous amide. InChIKey: UKYNTNATMCCWNO-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | N-(2-benzoyl-4-chlorophenyl)-N-methylnitrous amide |
| InChIKey | UKYNTNATMCCWNO-UHFFFAOYSA-N |
| SMILES | CN(C1=C(C=C(C=C1)Cl)C(=O)C2=CC=CC=C2)N=O |
Computed by PubChem (NCBI)