CAS 96138-46-4 is the registry number for 1–(3–Chlorophenyl)–3,4–dimethylpyrano(2,3–c)pyrazol–6(1H)–one. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
1-(3-chlorophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one (CAS 96138-46-4) is a chemical compound with the molecular formula C14H11ClN2O2 and a molecular weight of 274.70 g/mol. IUPAC name: 1-(3-chlorophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one. InChIKey: PCYZCHDRKUBVSH-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one |
| InChIKey | PCYZCHDRKUBVSH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C(=NN2C3=CC(=CC=C3)Cl)C |
Computed by PubChem (NCBI)