Products 1284418-58-1
CAS 1284418-58-1 appears in our catalog under these names: 2-(4-Chlorophenyl)-4-cyclopropylpyrimidine-5-carboxylic acid, 95%, 95%, 2-(4-Chlorophenyl)-4-cyclopropylpyrimidine-5-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1mg.
2-(4-chlorophenyl)-4-cyclopropylpyrimidine-5-carboxylic acid (CAS 1284418-58-1) is a chemical compound with the molecular formula C14H11ClN2O2 and a molecular weight of 274.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-4-cyclopropylpyrimidine-5-carboxylic acid. InChIKey: NZQADXGNXJGYOT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4-cyclopropylpyrimidine-5-carboxylic acid |
| InChIKey | NZQADXGNXJGYOT-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=NC=C2C(=O)O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)