CAS 85094-37-7 is the registry number for 5–Chloro–3,4–dimethyl–1–phenylpyrano(2,3–c)pyrazol–6(1H)–one. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
5-chloro-3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one (CAS 85094-37-7) is a chemical compound with the molecular formula C14H11ClN2O2 and a molecular weight of 274.70 g/mol. IUPAC name: 5-chloro-3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one. InChIKey: ASFLSTKFJDWSSH-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 5-chloro-3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one |
| InChIKey | ASFLSTKFJDWSSH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C(=NN2C3=CC=CC=C3)C)Cl |
Computed by PubChem (NCBI)