CAS 1240529-26-3 is the registry number for 2,3-Dihydro-1,4-benzodioxin-5-ylmethanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2,3-dihydro-1,4-benzodioxin-5-ylmethanamine;dihydrochloride (CAS 1240529-26-3) is a chemical compound with the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-5-ylmethanamine;dihydrochloride. InChIKey: TVHPRBWRLRJJDT-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO2 |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-5-ylmethanamine;dihydrochloride |
| InChIKey | TVHPRBWRLRJJDT-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC=C2O1)CN.Cl.Cl |
Computed by PubChem (NCBI)