CAS 2171916-63-3 is the registry number for (3-Chloro-4,5-dimethoxyphenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(3-chloro-4,5-dimethoxyphenyl)methanamine;hydrochloride (CAS 2171916-63-3) is a chemical compound with the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. IUPAC name: (3-chloro-4,5-dimethoxyphenyl)methanamine;hydrochloride. InChIKey: XZBFCUBKRBQPHS-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO2 |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | (3-chloro-4,5-dimethoxyphenyl)methanamine;hydrochloride |
| InChIKey | XZBFCUBKRBQPHS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CN)Cl)OC.Cl |
Computed by PubChem (NCBI)