Products 2044714-54-5
CAS 2044714-54-5 is the registry number for 2-Amino-1-(4-chlorophenyl)propane-1,3-diol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-1-(4-chlorophenyl)propane-1,3-diol;hydrochloride (CAS 2044714-54-5) is a chemical compound with the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. IUPAC name: 2-amino-1-(4-chlorophenyl)propane-1,3-diol;hydrochloride. InChIKey: FYUVPJRAXNFRLC-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO2 |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 2-amino-1-(4-chlorophenyl)propane-1,3-diol;hydrochloride |
| InChIKey | FYUVPJRAXNFRLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(CO)N)O)Cl.Cl |
Computed by PubChem (NCBI)