CAS 3026717-11-0 appears in our catalog under these names: 2-Amino-2-(3-chloro-4-methoxyphenyl)ethan-1-ol hydrochloride, 98%, 98%, 2-Amino-2-(3-chloro-4-methoxyphenyl)ethan-1-ol (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-amino-2-(3-chloro-4-methoxyphenyl)ethanol;hydrochloride (CAS 3026717-11-0) is a chemical compound with the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. IUPAC name: 2-amino-2-(3-chloro-4-methoxyphenyl)ethanol;hydrochloride. InChIKey: NXVCMRXBZUCGNE-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO2 |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 2-amino-2-(3-chloro-4-methoxyphenyl)ethanol;hydrochloride |
| InChIKey | NXVCMRXBZUCGNE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(CO)N)Cl.Cl |
Computed by PubChem (NCBI)