CAS 1240585-52-7 appears in our catalog under these names: (3S)-3-Phenylpiperazin-2-one, 95%, (S)–3–Phenylpiperazin–2–one, (S)-3-Phenyl-2-piperazinone, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(3S)-3-phenylpiperazin-2-one (CAS 1240585-52-7) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: (3S)-3-phenylpiperazin-2-one. InChIKey: WKFFHKBGGZHQAX-VIFPVBQESA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (3S)-3-phenylpiperazin-2-one |
| InChIKey | WKFFHKBGGZHQAX-VIFPVBQESA-N |
| SMILES | C1CNC(=O)[C@@H](N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)