CAS 5368-28-5 appears in our catalog under these names: 3-phenylpiperazin-2-one, 95%, 2–Piperazinone,3–phenyl–, 3-Phenylpiperazin-2-one 97%, 3-Phenylpiperazin-2-one, 97%, 97%, 3-phenylpiperazin-2-one, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-phenylpiperazin-2-one (CAS 5368-28-5) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 3-phenylpiperazin-2-one. InChIKey: WKFFHKBGGZHQAX-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-phenylpiperazin-2-one |
| InChIKey | WKFFHKBGGZHQAX-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C(N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)