Products 1240594-41-5
CAS 1240594-41-5 is the registry number for 2,5-DICHLOROPYRIMIDINE-4-CARBOXYLIC ACID, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
2,5-dichloropyrimidine-4-carboxylic acid (CAS 1240594-41-5) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,5-dichloropyrimidine-4-carboxylic acid. InChIKey: OSDYPLYOFIWZEU-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,5-dichloropyrimidine-4-carboxylic acid |
| InChIKey | OSDYPLYOFIWZEU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)