Products 1241677-24-6
CAS 1241677-24-6 is the registry number for (S)-6,7-Dichloro-2,3-dihydrobenzofuran-3-amine, 97%. Offered by: BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(3S)-6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine (CAS 1241677-24-6) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: (3S)-6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: URMAYQIYUBDETJ-ZCFIWIBFSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | (3S)-6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | URMAYQIYUBDETJ-ZCFIWIBFSA-N |
| SMILES | C1[C@H](C2=C(O1)C(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)