CAS 1241677-90-6 appears in our catalog under these names: (2R)-2-Amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid, 95%, (R)–2–Amino–3–(4–(trifluoromethoxy)phenyl)propanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(2R)-2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid (CAS 1241677-90-6) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: (2R)-2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: YZXUCQCJZKJMIR-MRVPVSSYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | (2R)-2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | YZXUCQCJZKJMIR-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)OC(F)(F)F |
Computed by PubChem (NCBI)