CAS 2270912-27-9 is the registry number for 4-Hydroxy-n-methyl-3-(2,2,2-trifluoro-ethoxy)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-hydroxy-N-methyl-3-(2,2,2-trifluoroethoxy)benzamide (CAS 2270912-27-9) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: 4-hydroxy-N-methyl-3-(2,2,2-trifluoroethoxy)benzamide. InChIKey: TZMPREAMYVQTSN-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | 4-hydroxy-N-methyl-3-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | TZMPREAMYVQTSN-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1)O)OCC(F)(F)F |
Computed by PubChem (NCBI)