CAS 605680-62-4 appears in our catalog under these names: 2-Methyl-2-(5-(trifluoromethyl)pyridin-2-yloxy)propanoic acid, 95%, 2–Methyl–2–(5–(trifluoromethyl)pyridin–2–yloxy)propanoic acid, 2-Methyl-2-(5-(trifluoromethyl)pyridin-2-yloxy)propanoic acid 95%, 2-Methyl-2-(5-(trifluoromethyl)pyridin-2-yloxy)propanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanoic acid (CAS 605680-62-4) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: 2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanoic acid. InChIKey: ZUTDVFRJNNKHND-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | 2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanoic acid |
| InChIKey | ZUTDVFRJNNKHND-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=NC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)