CAS 1096863-64-7 appears in our catalog under these names: Methyl 4-amino-3-(2,2,2-trifluoroethoxy)benzoate, 95%, Methyl 4-amino-3-(2,2,2-trifluoroethoxy)benzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
Methyl 4-amino-3-(2,2,2-trifluoroethoxy)benzoate (CAS 1096863-64-7) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: methyl 4-amino-3-(2,2,2-trifluoroethoxy)benzoate. InChIKey: OYZHTBVZZYAWAX-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | methyl 4-amino-3-(2,2,2-trifluoroethoxy)benzoate |
| InChIKey | OYZHTBVZZYAWAX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N)OCC(F)(F)F |
Computed by PubChem (NCBI)