CAS 1970385-57-9 is the registry number for 4-Amino-2-(2,2,2-trifluoro-ethoxy)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-amino-2-(2,2,2-trifluoroethoxy)benzoate (CAS 1970385-57-9) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: methyl 4-amino-2-(2,2,2-trifluoroethoxy)benzoate. InChIKey: JYVPMDVRXYNZEC-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | methyl 4-amino-2-(2,2,2-trifluoroethoxy)benzoate |
| InChIKey | JYVPMDVRXYNZEC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)OCC(F)(F)F |
Computed by PubChem (NCBI)