CAS 2301067-29-6 is the registry number for 4-Hydroxy-n,n-dimethyl-2-trifluoromethoxy-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-hydroxy-N,N-dimethyl-2-(trifluoromethoxy)benzamide (CAS 2301067-29-6) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: 4-hydroxy-N,N-dimethyl-2-(trifluoromethoxy)benzamide. InChIKey: XHEZOOUZASLYQP-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | 4-hydroxy-N,N-dimethyl-2-(trifluoromethoxy)benzamide |
| InChIKey | XHEZOOUZASLYQP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)O)OC(F)(F)F |
Computed by PubChem (NCBI)