CAS 1241680-31-8 is the registry number for (2R)-2-Amino-3-(3,5-dichlorophenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2R)-2-amino-3-(3,5-dichlorophenyl)propanoic acid (CAS 1241680-31-8) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (2R)-2-amino-3-(3,5-dichlorophenyl)propanoic acid. InChIKey: UAODYKLBUMXKDC-MRVPVSSYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(3,5-dichlorophenyl)propanoic acid |
| InChIKey | UAODYKLBUMXKDC-MRVPVSSYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)