CAS 1241684-03-6 is the registry number for (R)–2–Amino–3–(2,6–dichlorophenyl)propanoic acid. Offered by: GLPBio. Available pack sizes: 1g.
(2R)-2-amino-3-(2,6-dichlorophenyl)propanoic acid (CAS 1241684-03-6) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (2R)-2-amino-3-(2,6-dichlorophenyl)propanoic acid. InChIKey: LWFYNRYRKMEIIJ-MRVPVSSYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,6-dichlorophenyl)propanoic acid |
| InChIKey | LWFYNRYRKMEIIJ-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)