CAS 1242339-40-7 appears in our catalog under these names: 5-Chloro-4-fluoro-2-methylbenzenesulfonyl chloride, 95%, 5–Chloro–4–fluoro–2–methylbenzenesulfonyl chloride, 5-Chloro-4-fluoro-2-methylbenzenesulfonyl chloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
5-chloro-4-fluoro-2-methylbenzenesulfonyl chloride (CAS 1242339-40-7) is a chemical compound with the molecular formula C7H5Cl2FO2S and a molecular weight of 243.08 g/mol. IUPAC name: 5-chloro-4-fluoro-2-methylbenzenesulfonyl chloride. InChIKey: RAYLWLGLEWDHBZ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FO2S |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2-methylbenzenesulfonyl chloride |
| InChIKey | RAYLWLGLEWDHBZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)Cl)F |
Computed by PubChem (NCBI)