Products 1242339-40-7

CAS 1242339-40-7 appears in our catalog under these names: 5-Chloro-4-fluoro-2-methylbenzenesulfonyl chloride, 95%, 5–Chloro–4–fluoro–2–methylbenzenesulfonyl chloride, 5-Chloro-4-fluoro-2-methylbenzenesulfonyl chloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-chloro-4-fluoro-2-methylbenzenesulfonyl chloride (CAS 1242339-40-7) is a chemical compound with the molecular formula C7H5Cl2FO2S and a molecular weight of 243.08 g/mol. IUPAC name: 5-chloro-4-fluoro-2-methylbenzenesulfonyl chloride. InChIKey: RAYLWLGLEWDHBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2FO2S
Molecular weight243.08 g/mol
IUPAC name5-chloro-4-fluoro-2-methylbenzenesulfonyl chloride
InChIKeyRAYLWLGLEWDHBZ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1S(=O)(=O)Cl)Cl)F

Computed by PubChem (NCBI)