CAS 868755-70-8 appears in our catalog under these names: 4-Chloro-2-fluoro-5-methylbenzenesulfonyl chloride, 95%, 4–Chloro–2–fluoro–5–methylbenzene–1–sulfonyl chloride, 4-Chloro-2-fluoro-5-methylbenzene-1-sulfonyl chloride 95%, 4-Chloro-2-fluoro-5-methylbenzenesulfonyl chloride, 98%, 98%, 4-CHLORO-2-FLUORO-5-METHYLPHENYLSULFONYL CHLORIDE, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-chloro-2-fluoro-5-methylbenzenesulfonyl chloride (CAS 868755-70-8) is a chemical compound with the molecular formula C7H5Cl2FO2S and a molecular weight of 243.08 g/mol. IUPAC name: 4-chloro-2-fluoro-5-methylbenzenesulfonyl chloride. InChIKey: HHPBVNJGNFMCKA-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FO2S |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | 4-chloro-2-fluoro-5-methylbenzenesulfonyl chloride |
| InChIKey | HHPBVNJGNFMCKA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)