Products 1308384-59-9
CAS 1308384-59-9 is the registry number for (2-Chloro-5-fluorophenyl)methanesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(2-chloro-5-fluorophenyl)methanesulfonyl chloride (CAS 1308384-59-9) is a chemical compound with the molecular formula C7H5Cl2FO2S and a molecular weight of 243.08 g/mol. IUPAC name: (2-chloro-5-fluorophenyl)methanesulfonyl chloride. InChIKey: WKXDGNCTCLTUHF-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FO2S |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | (2-chloro-5-fluorophenyl)methanesulfonyl chloride |
| InChIKey | WKXDGNCTCLTUHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CS(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)