Products 1314961-07-3
CAS 1314961-07-3 appears in our catalog under these names: (5-Chloro-2-fluorophenyl)methanesulfonyl chloride, 95%, (5-Chloro-2-fluorophenyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(5-chloro-2-fluorophenyl)methanesulfonyl chloride (CAS 1314961-07-3) is a chemical compound with the molecular formula C7H5Cl2FO2S and a molecular weight of 243.08 g/mol. IUPAC name: (5-chloro-2-fluorophenyl)methanesulfonyl chloride. InChIKey: INWXMMCWWWQZNJ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FO2S |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | (5-chloro-2-fluorophenyl)methanesulfonyl chloride |
| InChIKey | INWXMMCWWWQZNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CS(=O)(=O)Cl)F |
Computed by PubChem (NCBI)