Products 926257-07-0

CAS 926257-07-0 is the registry number for (2-Chloro-6-fluorophenyl)methanesulfonyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

(2-chloro-6-fluorophenyl)methanesulfonyl chloride (CAS 926257-07-0) is a chemical compound with the molecular formula C7H5Cl2FO2S and a molecular weight of 243.08 g/mol. IUPAC name: (2-chloro-6-fluorophenyl)methanesulfonyl chloride. InChIKey: VFDXEVWUTIVWCR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2FO2S
Molecular weight243.08 g/mol
IUPAC name(2-chloro-6-fluorophenyl)methanesulfonyl chloride
InChIKeyVFDXEVWUTIVWCR-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)CS(=O)(=O)Cl)F

Computed by PubChem (NCBI)