Products 541528-45-4

CAS 541528-45-4 appears in our catalog under these names: (2-Chloro-4-fluorophenyl)methanesulfonyl chloride, 95%, (2-Chloro-4-fluorophenyl)methanesulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

(2-chloro-4-fluorophenyl)methanesulfonyl chloride (CAS 541528-45-4) is a chemical compound with the molecular formula C7H5Cl2FO2S and a molecular weight of 243.08 g/mol. IUPAC name: (2-chloro-4-fluorophenyl)methanesulfonyl chloride. InChIKey: CGJQTABGNOEWSS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2FO2S
Molecular weight243.08 g/mol
IUPAC name(2-chloro-4-fluorophenyl)methanesulfonyl chloride
InChIKeyCGJQTABGNOEWSS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)Cl)CS(=O)(=O)Cl

Computed by PubChem (NCBI)