Products 541528-45-4
CAS 541528-45-4 appears in our catalog under these names: (2-Chloro-4-fluorophenyl)methanesulfonyl chloride, 95%, (2-Chloro-4-fluorophenyl)methanesulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
(2-chloro-4-fluorophenyl)methanesulfonyl chloride (CAS 541528-45-4) is a chemical compound with the molecular formula C7H5Cl2FO2S and a molecular weight of 243.08 g/mol. IUPAC name: (2-chloro-4-fluorophenyl)methanesulfonyl chloride. InChIKey: CGJQTABGNOEWSS-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FO2S |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | (2-chloro-4-fluorophenyl)methanesulfonyl chloride |
| InChIKey | CGJQTABGNOEWSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)