CAS 1242867-26-0 is the registry number for (2,7-Dimethyl-3-oxo-2,3-dihydro-4h-1,4-benzoxazin-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2,7-dimethyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid (CAS 1242867-26-0) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 2-(2,7-dimethyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid. InChIKey: WEJIZGLLPNLQKQ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 2-(2,7-dimethyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid |
| InChIKey | WEJIZGLLPNLQKQ-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(C2=C(O1)C=C(C=C2)C)CC(=O)O |
Computed by PubChem (NCBI)