CAS 1243368-67-3 is the registry number for 5-Cyclopropoxynicotinic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-cyclopropyloxypyridine-3-carboxylic acid (CAS 1243368-67-3) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 5-cyclopropyloxypyridine-3-carboxylic acid. InChIKey: CCQPOUSMAWMBAL-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 5-cyclopropyloxypyridine-3-carboxylic acid |
| InChIKey | CCQPOUSMAWMBAL-UHFFFAOYSA-N |
| SMILES | C1CC1OC2=CN=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)