CAS 1244948-84-2 is the registry number for 2,2-Dioxo-1,3-dihydro-2λâ¶,1-benzothiazole-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dioxo-1,3-dihydro-2,1-benzothiazole-6-carboxylic acid (CAS 1244948-84-2) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 2,2-dioxo-1,3-dihydro-2,1-benzothiazole-6-carboxylic acid. InChIKey: WOYVITVQQNYCEQ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 2,2-dioxo-1,3-dihydro-2,1-benzothiazole-6-carboxylic acid |
| InChIKey | WOYVITVQQNYCEQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C(=O)O)NS1(=O)=O |
Computed by PubChem (NCBI)