CAS 1245708-33-1 appears in our catalog under these names: 7-Bromo-2-methyl-3,4-dihydro-2h-1,4-benzoxazin-3-one, 95%, 7-Bromo-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-one, 7-Bromo-2-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%, 98%, 7-BROMO-2-METHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
7-bromo-2-methyl-4H-1,4-benzoxazin-3-one (CAS 1245708-33-1) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 7-bromo-2-methyl-4H-1,4-benzoxazin-3-one. InChIKey: QVEHEXXQFGINCG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 7-bromo-2-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | QVEHEXXQFGINCG-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=C(C=C2)Br |
Computed by PubChem (NCBI)