CAS 124605-42-1 appears in our catalog under these names: Docetaxel Impurity 50, Methyl (2R,3S)-N-boc-3-phenylisoserine, (2R,3S)-Boc-3-Ph-Isoser-OMe 97%, (2R,3S)-N-Boc-3-phenylisoserine methyl ester, 97%, 97%, (2R,3S)-N-Boc-3-phenylisoserine methyl ester, 98%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 2g, 5g, 10g, 25g, 250mg, 1g, 100g.
Methyl (2R,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 124605-42-1) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: methyl (2R,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: NCALQERIBRYGOK-NWDGAFQWSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | methyl (2R,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| InChIKey | NCALQERIBRYGOK-NWDGAFQWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC=CC=C1)[C@H](C(=O)OC)O |
Computed by PubChem (NCBI)