CAS 959123-35-4 appears in our catalog under these names: Docetaxel Impurity 33, Cabazitaxel Impurity 45, Dedimethoxy-10-deacetylbaccatin III Cabazitaxel. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Methyl (2R,3R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 959123-35-4) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: methyl (2R,3R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: NCALQERIBRYGOK-VXGBXAGGSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | methyl (2R,3R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| InChIKey | NCALQERIBRYGOK-VXGBXAGGSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC=CC=C1)[C@H](C(=O)OC)O |
Computed by PubChem (NCBI)