Products 1246209-90-4
CAS 1246209-90-4 is the registry number for Methyl 2-amino-4-chloroquinazoline-7-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-amino-4-chloroquinazoline-7-carboxylate (CAS 1246209-90-4) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: methyl 2-amino-4-chloroquinazoline-7-carboxylate. InChIKey: SOBWVRZIMHVNEV-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | methyl 2-amino-4-chloroquinazoline-7-carboxylate |
| InChIKey | SOBWVRZIMHVNEV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)