Products 99074-45-0

CAS 99074-45-0 is the registry number for 1-(2-Chlorophenyl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

1-(2-chlorophenyl)-5-methyltriazole-4-carboxylic acid (CAS 99074-45-0) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: 1-(2-chlorophenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: LFEXQNUUUHXDEE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClN3O2
Molecular weight237.64 g/mol
IUPAC name1-(2-chlorophenyl)-5-methyltriazole-4-carboxylic acid
InChIKeyLFEXQNUUUHXDEE-UHFFFAOYSA-N
SMILESCC1=C(N=NN1C2=CC=CC=C2Cl)C(=O)O

Computed by PubChem (NCBI)