CAS 1807979-67-4 is the registry number for 1-Benzyl-5-chloro-1h-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-benzyl-5-chloro-1,2,4-triazole-3-carboxylic acid (CAS 1807979-67-4) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: 1-benzyl-5-chloro-1,2,4-triazole-3-carboxylic acid. InChIKey: GJXQCBFRUQITFG-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 1-benzyl-5-chloro-1,2,4-triazole-3-carboxylic acid |
| InChIKey | GJXQCBFRUQITFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)