CAS 1368502-79-7 is the registry number for 2-Chloro-4-(3-methyl-1h-1,2,4-triazol-1-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-4-(3-methyl-1,2,4-triazol-1-yl)benzoic acid (CAS 1368502-79-7) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: 2-chloro-4-(3-methyl-1,2,4-triazol-1-yl)benzoic acid. InChIKey: QOUISVPIKAUQAR-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 2-chloro-4-(3-methyl-1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | QOUISVPIKAUQAR-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=N1)C2=CC(=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)