CAS 1781909-34-9 is the registry number for 1-(4-Chlorobenzyl)-1h-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(4-chlorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid (CAS 1781909-34-9) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid. InChIKey: PPEJIWUDMXDUNO-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid |
| InChIKey | PPEJIWUDMXDUNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)