CAS 1279219-63-4 is the registry number for Methyl 2-(3-chloro-1h-1,2,4-triazol-5-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate (CAS 1279219-63-4) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate. InChIKey: DNBDSFFMMLCHQY-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate |
| InChIKey | DNBDSFFMMLCHQY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1C2=NNC(=N2)Cl |
Computed by PubChem (NCBI)