CAS 1246242-17-0 appears in our catalog under these names: 8-Isopropylquinoline 1-oxide, 95%, 8-Isopropylquinoline 1-oxide, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, on request.
1-oxido-8-propan-2-ylquinolin-1-ium (CAS 1246242-17-0) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 1-oxido-8-propan-2-ylquinolin-1-ium. InChIKey: LYLSTLGFFOQSKE-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1-oxido-8-propan-2-ylquinolin-1-ium |
| InChIKey | LYLSTLGFFOQSKE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC2=C1[N+](=CC=C2)[O-] |
Computed by PubChem (NCBI)