CAS 1246370-78-4 appears in our catalog under these names: (S)-2-Amino-3-(3,4-dihydroxyphenyl)propanamide hydrochloride, 95%, (S)–2–Amino–3–(3,4–dihydroxyphenyl)propanamide hydrochloride, (2S)-2-Amino-3-(3,4-dihydroxyphenyl)propanamide hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanamide;hydrochloride (CAS 1246370-78-4) is a chemical compound with the molecular formula C9H13ClN2O3 and a molecular weight of 232.66 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanamide;hydrochloride. InChIKey: UNHOHVHNGUNDRU-RGMNGODLSA-N.
| Molecular formula | C9H13ClN2O3 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanamide;hydrochloride |
| InChIKey | UNHOHVHNGUNDRU-RGMNGODLSA-N |
| SMILES | C1=CC(=C(C=C1C[C@@H](C(=O)N)N)O)O.Cl |
Computed by PubChem (NCBI)