CAS 346705-17-7 appears in our catalog under these names: ((4-Methoxy-3-nitrophenyl)methyl)(methyl)amine hydrochloride, 95%, ((4-Methoxy-3-nitrophenyl)methyl)(methyl)amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-(4-methoxy-3-nitrophenyl)-N-methylmethanamine;hydrochloride (CAS 346705-17-7) is a chemical compound with the molecular formula C9H13ClN2O3 and a molecular weight of 232.66 g/mol. IUPAC name: 1-(4-methoxy-3-nitrophenyl)-N-methylmethanamine;hydrochloride. InChIKey: OMHKSPISAWUBFW-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O3 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 1-(4-methoxy-3-nitrophenyl)-N-methylmethanamine;hydrochloride |
| InChIKey | OMHKSPISAWUBFW-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=C(C=C1)OC)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)