CAS 1421602-76-7 appears in our catalog under these names: 3-(4,6-Dimethyl-2-oxo-1,2-dihydropyrimidin-5-yl)propanoic acid hydrochloride, 95%, 3-(4,6-Dimethyl-2-oxo-1,2-dihydropyrimidin-5-yl)propanoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride (CAS 1421602-76-7) is a chemical compound with the molecular formula C9H13ClN2O3 and a molecular weight of 232.66 g/mol. IUPAC name: 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride. InChIKey: JDJJNJARYBJUBU-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O3 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)propanoic acid;hydrochloride |
| InChIKey | JDJJNJARYBJUBU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=O)N1)C)CCC(=O)O.Cl |
Computed by PubChem (NCBI)