CAS 1808654-76-3 is the registry number for (2S,3S)-3-((1H-Pyrazol-1-yl)methyl)tetrahydrofuran-2-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-3-(pyrazol-1-ylmethyl)oxolane-2-carboxylic acid;hydrochloride (CAS 1808654-76-3) is a chemical compound with the molecular formula C9H13ClN2O3 and a molecular weight of 232.66 g/mol. IUPAC name: (2S,3S)-3-(pyrazol-1-ylmethyl)oxolane-2-carboxylic acid;hydrochloride. InChIKey: CWPTWYDPYNNZEZ-WSZWBAFRSA-N.
| Molecular formula | C9H13ClN2O3 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | (2S,3S)-3-(pyrazol-1-ylmethyl)oxolane-2-carboxylic acid;hydrochloride |
| InChIKey | CWPTWYDPYNNZEZ-WSZWBAFRSA-N |
| SMILES | C1CO[C@@H]([C@@H]1CN2C=CC=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)