CAS 1401319-33-2 is the registry number for 2-Hydroxy-6-isobutylpyrimidine-4-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride (CAS 1401319-33-2) is a chemical compound with the molecular formula C9H13ClN2O3 and a molecular weight of 232.66 g/mol. IUPAC name: 6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride. InChIKey: BYEKQFVYFZAQDM-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O3 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride |
| InChIKey | BYEKQFVYFZAQDM-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC(=NC(=O)N1)C(=O)O.Cl |
Computed by PubChem (NCBI)