Products 1401319-33-2

CAS 1401319-33-2 is the registry number for 2-Hydroxy-6-isobutylpyrimidine-4-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride (CAS 1401319-33-2) is a chemical compound with the molecular formula C9H13ClN2O3 and a molecular weight of 232.66 g/mol. IUPAC name: 6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride. InChIKey: BYEKQFVYFZAQDM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClN2O3
Molecular weight232.66 g/mol
IUPAC name6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid;hydrochloride
InChIKeyBYEKQFVYFZAQDM-UHFFFAOYSA-N
SMILESCC(C)CC1=CC(=NC(=O)N1)C(=O)O.Cl

Computed by PubChem (NCBI)