CAS 25546-02-5 appears in our catalog under these names: 3-tert-Butyl-5-chloro-6-hydroxymethyluracil (6-Desmethyl-6-Hydroxymethyl Terbacil), >95% (HPLC), Terbacil-hydroxymethyl. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 10mg, 50mg.
3-tert-butyl-5-chloro-6-(hydroxymethyl)-1H-pyrimidine-2,4-dione (CAS 25546-02-5) is a chemical compound with the molecular formula C9H13ClN2O3 and a molecular weight of 232.66 g/mol. IUPAC name: 3-tert-butyl-5-chloro-6-(hydroxymethyl)-1H-pyrimidine-2,4-dione. InChIKey: JIWWBTSLDXVUJL-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O3 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 3-tert-butyl-5-chloro-6-(hydroxymethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | JIWWBTSLDXVUJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)C(=C(NC1=O)CO)Cl |
Computed by PubChem (NCBI)