Products 1246616-74-9

CAS 1246616-74-9 is the registry number for 4-Oxo-4H-pyran-2,5-dicarboxylic Acid 2,5-Diethyl Ester. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Diethyl 4-oxopyran-2,5-dicarboxylate (CAS 1246616-74-9) is a chemical compound with the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. IUPAC name: diethyl 4-oxopyran-2,5-dicarboxylate. InChIKey: RNIVGJYWHHSMKA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O6
Molecular weight240.21 g/mol
IUPAC namediethyl 4-oxopyran-2,5-dicarboxylate
InChIKeyRNIVGJYWHHSMKA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=O)C(=CO1)C(=O)OCC

Computed by PubChem (NCBI)