Products 91144-18-2

CAS 91144-18-2 is the registry number for 3-(4-Hydroxy-3,5-dimethoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-hydroxy-3,5-dimethoxyphenyl)-2-oxopropanoic acid (CAS 91144-18-2) is a chemical compound with the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. IUPAC name: 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-oxopropanoic acid. InChIKey: OSIRPBGXEVFDDH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O6
Molecular weight240.21 g/mol
IUPAC name3-(4-hydroxy-3,5-dimethoxyphenyl)-2-oxopropanoic acid
InChIKeyOSIRPBGXEVFDDH-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1O)OC)CC(=O)C(=O)O

Computed by PubChem (NCBI)