Products 2243587-05-3

CAS 2243587-05-3 is the registry number for 2-(4-Formyl-3,5-dimethoxyphenoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 2g, 5g, 10g, 50g, 25g.

Structural formula: {0} (CAS {1})

2-(4-formyl-3,5-dimethoxyphenoxy)acetic acid (CAS 2243587-05-3) is a chemical compound with the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. IUPAC name: 2-(4-formyl-3,5-dimethoxyphenoxy)acetic acid. InChIKey: OOOZITJSAZWJPA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O6
Molecular weight240.21 g/mol
IUPAC name2-(4-formyl-3,5-dimethoxyphenoxy)acetic acid
InChIKeyOOOZITJSAZWJPA-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1C=O)OC)OCC(=O)O

Computed by PubChem (NCBI)